2-[2-(4-butoxyphenyl)ethoxy]-N,N-diethyl-ethanamine structure
|
Common Name | 2-[2-(4-butoxyphenyl)ethoxy]-N,N-diethyl-ethanamine | ||
|---|---|---|---|---|
| CAS Number | 27078-31-5 | Molecular Weight | 293.44400 | |
| Density | 0.951g/cm3 | Boiling Point | 381.9ºC at 760mmHg | |
| Molecular Formula | C18H31NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 105.1ºC | |
| Name | 2-[2-(4-butoxyphenyl)ethoxy]-N,N-diethylethanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 0.951g/cm3 |
|---|---|
| Boiling Point | 381.9ºC at 760mmHg |
| Molecular Formula | C18H31NO2 |
| Molecular Weight | 293.44400 |
| Flash Point | 105.1ºC |
| Exact Mass | 293.23500 |
| PSA | 21.70000 |
| LogP | 3.76640 |
| Vapour Pressure | 4.91E-06mmHg at 25°C |
| Index of Refraction | 1.493 |
| InChIKey | PLAZAZSYDFEYMV-UHFFFAOYSA-N |
| SMILES | CCCCOc1ccc(CCOCCN(CC)CC)cc1 |
| HS Code | 2922199090 |
|---|
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-[2-(4-BUTOXYPHENYL)ETHOXY]-N,N-DIETHYL-ETHANAMINE |
| (2-Diethylamino-ethyl)-(4-butyloxy-phenethyl)-ether |
| (p-Butoxyphenethoxy)-2-diethylamino-1-ethan |
| 2-((p-Butoxyphenethyl)oxy)triethylamine |
| (2-Diethylamino-ethyl)-<2-(4-butyloxy-phenyl)-ethyl>-ether |
| Triethylamine,2-((p-butoxyphenethyl)oxy) |