(s)-3-amino-4-(4-trifluoromethylphenyl)butanoic acid hydrochloride structure
|
Common Name | (s)-3-amino-4-(4-trifluoromethylphenyl)butanoic acid hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 270065-79-7 | Molecular Weight | 283.675 | |
| Density | 1.318 | Boiling Point | 334ºC at 760mmHg | |
| Molecular Formula | C11H13ClF3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 155.8ºC | |
| Name | (3S)-3-amino-4-[4-(trifluoromethyl)phenyl]butanoic acid,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.318 |
|---|---|
| Boiling Point | 334ºC at 760mmHg |
| Molecular Formula | C11H13ClF3NO2 |
| Molecular Weight | 283.675 |
| Flash Point | 155.8ºC |
| Exact Mass | 283.058685 |
| PSA | 63.32000 |
| LogP | 3.55220 |
| Vapour Pressure | 5.21E-05mmHg at 25°C |
| InChIKey | AAAGEGKCWDZYHR-FVGYRXGTSA-N |
| SMILES | Cl.NC(CC(=O)O)Cc1ccc(C(F)(F)F)cc1 |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| (3S)-3-Amino-4-[4-(trifluoromethyl)phenyl]butanoic acid hydrochloride |
| (S)-3-Amino-4-(4-trifluoromethylphenyl)butanoic acid hydrochloride |
| (S)-3-Amino-4-(4-trifluoromethylphenyl)butanoicacid |
| (3S)-3-Amino-4-[4-(trifluoromethyl)phenyl]butanoic acid hydrochloride (1:1) |
| Benzenebutanoic acid, β-amino-4-(trifluoromethyl)-, (βS)-, hydrochloride (1:1) |
| (S)-3-Amino-4-(4-trifluoromethyl-phenyl)-butyric acid-HCl |