(s)-3-amino-4-(2-naphthyl)butanoic acid hydrochloride structure
|
Common Name | (s)-3-amino-4-(2-naphthyl)butanoic acid hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 270063-39-3 | Molecular Weight | 265.735 | |
| Density | N/A | Boiling Point | 430ºC at 760mmHg | |
| Molecular Formula | C14H16ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.9ºC | |
| Name | (3S)-3-amino-4-naphthalen-2-ylbutanoic acid,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 430ºC at 760mmHg |
|---|---|
| Molecular Formula | C14H16ClNO2 |
| Molecular Weight | 265.735 |
| Flash Point | 213.9ºC |
| Exact Mass | 265.086945 |
| PSA | 63.32000 |
| LogP | 3.68660 |
| Vapour Pressure | 3.69E-08mmHg at 25°C |
| InChIKey | WSVMIVFELRCSPA-ZDUSSCGKSA-N |
| SMILES | NC(CC(=O)O)Cc1ccc2ccccc2c1 |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| (S)-3-Amino-4-(2-naphthyl)butyricacidhydrochloride |
| (S)-3-AMINO-4-(2-NAPHTHYL)BUTANOIC ACID HYDROCHLORIDE |
| 2-Naphthalenebutanoic acid, β-amino-, (βR)-, hydrochloride (1:1) |
| (3R)-3-Amino-4-(2-naphthyl)butanoic acid hydrochloride (1:1) |
| (3R)-3-Amino-4-(2-naphthyl)butanoic acid hydrochloride |
| MFCD01861035 |
| (3R)-3-Amino-4-(naphthalen-2-yl)butanoic acid hydrochloride |
| (S)-3-Amino-4-(naphthalen-2-yl)butanoic acid hydrochloride |