1,1,1,2-tetrachloro-2,2-dimethyldisilane structure
|
Common Name | 1,1,1,2-tetrachloro-2,2-dimethyldisilane | ||
|---|---|---|---|---|
| CAS Number | 26980-43-8 | Molecular Weight | 228.05200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C2H6Cl4Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,1,1,2-tetrachloro-2,2-dimethyldisilane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C2H6Cl4Si2 |
|---|---|
| Molecular Weight | 228.05200 |
| Exact Mass | 225.87600 |
| LogP | 3.16400 |
| InChIKey | PVGYYKBIUKOMTG-UHFFFAOYSA-N |
| SMILES | C[Si](C)(Cl)[Si](Cl)(Cl)Cl |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| dimethyltetrachlorodisilane |
| 1,1,1,2-tetrachlorodimethyldisilane |
| tetrachlorodimethyldisilane |
| 1,1-dimethyltetrachlorodisilane |