Cyperaquinone
Modify Date: 2025-09-14 20:16:48
Cyperaquinone structure
|
Common Name | Cyperaquinone | ||
|---|---|---|---|---|
| CAS Number | 26962-40-3 | Molecular Weight | 242.22700 | |
| Density | 1.297g/cm3 | Boiling Point | 411ºC at 760mmHg | |
| Molecular Formula | C14H10O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198ºC | |
| Name | 5-methyl-2-prop-1-en-2-ylfuro[3,2-f][1]benzofuran-4,8-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.297g/cm3 |
|---|---|
| Boiling Point | 411ºC at 760mmHg |
| Molecular Formula | C14H10O4 |
| Molecular Weight | 242.22700 |
| Flash Point | 198ºC |
| Exact Mass | 242.05800 |
| PSA | 60.42000 |
| LogP | 2.98950 |
| Vapour Pressure | 5.76E-07mmHg at 25°C |
| Index of Refraction | 1.581 |
| InChIKey | KFMPVUGBZZOSGH-UHFFFAOYSA-N |
| SMILES | C=C(C)c1cc2c(o1)C(=O)c1occ(C)c1C2=O |
| HS Code | 2932190090 |
|---|
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Cyperaquinone |
| Benzo[1,2-b:5,4-b']difuran-4,8-dione,5-methyl-2-(1-methylethenyl) |
| 3-Methyl-6-prop-1-en-2-ylfuro(3,2-f(1)benzoxole-4,8-dione |
| 3-Methyl-6-prop-1-en-2-ylfuro[3,2-f][1]benzofuran-4,8-dione |
| 2-isopropenyl-5-methyl-benzo[1,2-b,5,4-b']difuran-4,8-dione |
| Cyperachinon |