6-[methyl(phenylsulphonyl)amino]hexanoic acid, compound with 2,2',2''-nitrilotriethanol (1:1) structure
|
Common Name | 6-[methyl(phenylsulphonyl)amino]hexanoic acid, compound with 2,2',2''-nitrilotriethanol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 26919-50-6 | Molecular Weight | 434.54700 | |
| Density | N/A | Boiling Point | 464.4ºC at 760 mmHg | |
| Molecular Formula | C19H34N2O7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 234.7ºC | |
| Name | 6-[benzenesulfonyl(methyl)amino]hexanoic acid,2-[bis(2-hydroxyethyl)amino]ethanol |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 464.4ºC at 760 mmHg |
|---|---|
| Molecular Formula | C19H34N2O7S |
| Molecular Weight | 434.54700 |
| Flash Point | 234.7ºC |
| Exact Mass | 434.20900 |
| PSA | 146.99000 |
| LogP | 1.29820 |
| Vapour Pressure | 2.01E-09mmHg at 25°C |
| InChIKey | ZRTNNBVVVUUNRM-UHFFFAOYSA-N |
| SMILES | CN(CCCCCC(=O)O)S(=O)(=O)c1ccccc1.OCCN(CCO)CCO |
| EINECS 248-107-3 |
| 6-(Methyl(phenylsulphonyl)amino)hexanoic acid,compound with 2,2',2''-nitrilotriethanol (1:1) |
| 6-(benzenesulfonyl-methyl-amino)hexanoic acid |
| 6-[methyl(phenylsulfonyl)amino]hexanoic acid-2,2',2''-nitrilotriethanol(1:1) |