Fmoc-3-amino-3-(4-bromophenyl)propionic acid
Modify Date: 2025-09-10 19:57:25
Fmoc-3-amino-3-(4-bromophenyl)propionic acid structure
|
Common Name | Fmoc-3-amino-3-(4-bromophenyl)propionic acid | ||
|---|---|---|---|---|
| CAS Number | 269078-76-4 | Molecular Weight | 466.324 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 664.4±55.0 °C at 760 mmHg | |
| Molecular Formula | C24H20BrNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 355.6±31.5 °C | |
| Name | 3-n-fmoc-3-(4-bromophenyl)propionic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 664.4±55.0 °C at 760 mmHg |
| Molecular Formula | C24H20BrNO4 |
| Molecular Weight | 466.324 |
| Flash Point | 355.6±31.5 °C |
| Exact Mass | 465.057556 |
| PSA | 75.63000 |
| LogP | 5.93 |
| Vapour Pressure | 0.0±2.1 mmHg at 25°C |
| Index of Refraction | 1.646 |
| InChIKey | GVCLAQFMSVKNKH-UHFFFAOYSA-N |
| SMILES | O=C(O)CC(NC(=O)OCC1c2ccccc2-c2ccccc21)c1ccc(Br)cc1 |
|
~46%
Fmoc-3-amino-3-... CAS#:269078-76-4 |
| Literature: Webster; Maude; O'Donnell; Mehrotra; Gani Journal of the Chemical Society. Perkin Transactions 1, 2001 , # 14 p. 1673 - 1695 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-(4-Bromophenyl)-3-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}propanoic acid |
| Benzenepropanoic acid, 4-bromo-β-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]- |