2-chloroethyl-[6-(2-chloroethylazaniumyl)hexyl]azanium,dichloride structure
|
Common Name | 2-chloroethyl-[6-(2-chloroethylazaniumyl)hexyl]azanium,dichloride | ||
|---|---|---|---|---|
| CAS Number | 26902-62-5 | Molecular Weight | 314.12300 | |
| Density | N/A | Boiling Point | 330.5ºC at 760mmHg | |
| Molecular Formula | C10H24Cl4N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 153.7ºC | |
| Name | 2-chloroethyl-[6-(2-chloroethylazaniumyl)hexyl]azanium,dichloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 330.5ºC at 760mmHg |
|---|---|
| Molecular Formula | C10H24Cl4N2 |
| Molecular Weight | 314.12300 |
| Flash Point | 153.7ºC |
| Exact Mass | 312.06900 |
| PSA | 24.06000 |
| LogP | 4.58940 |
| Vapour Pressure | 0.000165mmHg at 25°C |
| InChIKey | BNTYRLPHVFQBQP-UHFFFAOYSA-N |
| SMILES | ClCC[NH2+]CCCCCC[NH2+]CCCl.[Cl-].[Cl-] |
|
~%
2-chloroethyl-[... CAS#:26902-62-5 |
| Literature: Tuncel, Doenues; Steinke, Joachim H. G. Macromolecules, 2004 , vol. 37, # 2 p. 288 - 302 |
|
~%
2-chloroethyl-[... CAS#:26902-62-5 |
| Literature: Vargha et al. Journal of the Chemical Society, 1957 , p. 805,809 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| N,N'-bis-(2-chloro-ethyl)-hexanediyldiamine,dihydrochloride |
| N,N'-Bis(2-chloroethyl)-1,6-hexanediamine dihydrochloride |
| N,N'-bis(2-chloroethyl)hexane-1,6-diaminium dichloride |
| N,N'-Bis-(2-chlor-aethyl)-hexandiyldiamin,Dihydrochlorid |
| 1,6-HEXANEDIAMINE,N,N'-BIS(2-CHLOROETHYL)-,DIHYDROCHLORIDE |
| 2-chloroethyl-[6-(2-chloroethylazaniumyl)hexyl]azanium dichloride |