EBOV/MARV-IN-2
Modify Date: 2025-08-26 13:35:27
EBOV/MARV-IN-2 structure
|
Common Name | EBOV/MARV-IN-2 | ||
|---|---|---|---|---|
| CAS Number | 2687244-84-2 | Molecular Weight | 444.52 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H28N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of EBOV/MARV-IN-2EBOV/MARV-IN-2 (compound 13) is an Ebolavirus (EBOV, IC50=0.9 μM) and Marburg virus (MARV, IC50=2.7 μM) inhibitor[1]. |
| Name | EBOV/MARV-IN-2 |
|---|
| Description | EBOV/MARV-IN-2 (compound 13) is an Ebolavirus (EBOV, IC50=0.9 μM) and Marburg virus (MARV, IC50=2.7 μM) inhibitor[1]. |
|---|---|
| Related Catalog | |
| Target |
Ebolavirus (EBOV), Marburg virus (MARV)[1] |
| References |
| Molecular Formula | C27H28N2O4 |
|---|---|
| Molecular Weight | 444.52 |
| InChIKey | ZMGUBMQKEWGQGF-UHFFFAOYSA-N |
| SMILES | Cc1c(Cc2ccccc2)c(=O)oc2cc(OCC(O)CNCCc3ccncc3)ccc12 |