1,4-phenyldiglyoxal
Modify Date: 2025-09-22 02:42:50
1,4-phenyldiglyoxal structure
|
Common Name | 1,4-phenyldiglyoxal | ||
|---|---|---|---|---|
| CAS Number | 2673-16-7 | Molecular Weight | 190.15200 | |
| Density | 1.292g/cm3 | Boiling Point | 321.9ºC at 760mmHg | |
| Molecular Formula | C10H6O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 137.2ºC | |
| Name | 2-(4-oxaldehydoylphenyl)-2-oxoacetaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.292g/cm3 |
|---|---|
| Boiling Point | 321.9ºC at 760mmHg |
| Molecular Formula | C10H6O4 |
| Molecular Weight | 190.15200 |
| Flash Point | 137.2ºC |
| Exact Mass | 190.02700 |
| PSA | 68.28000 |
| LogP | 0.44980 |
| Vapour Pressure | 0.000289mmHg at 25°C |
| Index of Refraction | 1.547 |
| InChIKey | DTCYNRIBBFRFNN-UHFFFAOYSA-N |
| SMILES | O=CC(=O)c1ccc(C(=O)C=O)cc1 |
|
~18%
1,4-phenyldiglyoxal CAS#:2673-16-7 |
| Literature: Bruce, Michael J.; McLean, Gillian A.; Royles, Brodyck J. L.; Smith, David M.; Standring, Paul N. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1995 , # 14 p. 1789 - 1796 |
|
~%
1,4-phenyldiglyoxal CAS#:2673-16-7 |
| Literature: Ruggli; Gassenmeier Helvetica Chimica Acta, 1939 , vol. 22, p. 496,508 |
|
~%
1,4-phenyldiglyoxal CAS#:2673-16-7 |
| Literature: Ruggli; Gassenmeier Helvetica Chimica Acta, 1939 , vol. 22, p. 496,508 |
| p-Phenylen-diglyoxal |
| terephthalyl dicarboxaldehyde |
| 1,4-dioxoacetyl-benzene |
| 1,4-Phenyldiglyoxal |
| 1,4-Diglyoxyloyl-benzol |
| 1,4-Bisglyoxalylbenzen |
| 1,4-Diglyoxyloyl-benzol-dihydrat |
| p-Phenylenediglyoxal |
| Duren-1,4-bisglyoxal |