methyl 2-methylprop-2-enoate,prop-2-enyl 2-methylprop-2-enoate structure
|
Common Name | methyl 2-methylprop-2-enoate,prop-2-enyl 2-methylprop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 26715-19-5 | Molecular Weight | 226.26900 | |
| Density | N/A | Boiling Point | 138.6ºC at 760mmHg | |
| Molecular Formula | C12H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 33.9ºC | |
| Name | methyl 2-methylprop-2-enoate,prop-2-enyl 2-methylprop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 138.6ºC at 760mmHg |
|---|---|
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.26900 |
| Flash Point | 33.9ºC |
| Exact Mass | 226.12100 |
| PSA | 52.60000 |
| LogP | 2.02720 |
| Vapour Pressure | 6.68mmHg at 25°C |
| InChIKey | GZRUSOUFYFKYDY-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)OC.C=CCOC(=O)C(=C)C |
| 2-Propenoic acid,2-methyl-,methyl ester,polymer with 2-propenyl 2-methyl-2-propenoate |
| methyl 2-methylprop-2-enoate-prop-2-en-1-yl 2-methylprop-2-enoate(1:1) |
| Methyl methacrylate,allyl methacrylate polymer |
| Methyl methacrylate,polymer with allyl methacrylate |