DNA-PK-IN-1
Modify Date: 2025-08-27 08:16:38
DNA-PK-IN-1 structure
|
Common Name | DNA-PK-IN-1 | ||
|---|---|---|---|---|
| CAS Number | 2663850-40-4 | Molecular Weight | 446.50 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H26N8O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of DNA-PK-IN-1DNA-PK-IN-1 is a potent inhibitor of DNA-PK. DNA-dependent protein kinase (DNA-PK) is a DNA-PK enzyme complex composed of Ku70/Ku80 heterodimer and DNA-dependent protein kinase catalytic subunit (DNA-PKcs). DNA-PK-IN-1 has the potential for the research of cancer diseases (extracted from patent WO2021136463A1, compound 1)[1]. |
| Name | DNA-PK-IN-1 |
|---|
| Description | DNA-PK-IN-1 is a potent inhibitor of DNA-PK. DNA-dependent protein kinase (DNA-PK) is a DNA-PK enzyme complex composed of Ku70/Ku80 heterodimer and DNA-dependent protein kinase catalytic subunit (DNA-PKcs). DNA-PK-IN-1 has the potential for the research of cancer diseases (extracted from patent WO2021136463A1, compound 1)[1]. |
|---|---|
| Related Catalog | |
| References |
[1]. Yonggang Wei, et al. Purine derivatives and their use in medicine. Patent WO2021136463A1. |
| Molecular Formula | C23H26N8O2 |
|---|---|
| Molecular Weight | 446.50 |
| InChIKey | LUNNHYMBXZPWBL-UHFFFAOYSA-N |
| SMILES | Cc1cc2ncnn2cc1Nc1ncc2c(n1)n(C13CC4CC(CC(O)(C4)C1)C3)c(=O)n2C |