2-(3-oxo-1H-isoindol-2-yl)pentanedioic acid structure
|
Common Name | 2-(3-oxo-1H-isoindol-2-yl)pentanedioic acid | ||
|---|---|---|---|---|
| CAS Number | 26577-32-2 | Molecular Weight | 263.24600 | |
| Density | 1.458g/cm3 | Boiling Point | 541.8ºC at 760mmHg | |
| Molecular Formula | C13H13NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 281.5ºC | |
| Name | 2-(3-oxo-1H-isoindol-2-yl)pentanedioic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.458g/cm3 |
|---|---|
| Boiling Point | 541.8ºC at 760mmHg |
| Molecular Formula | C13H13NO5 |
| Molecular Weight | 263.24600 |
| Flash Point | 281.5ºC |
| Exact Mass | 263.07900 |
| PSA | 94.91000 |
| LogP | 0.89830 |
| Vapour Pressure | 1.43E-12mmHg at 25°C |
| Index of Refraction | 1.624 |
| InChIKey | RVTDLRPXGAMZGP-UHFFFAOYSA-N |
| SMILES | O=C(O)CCC(C(=O)O)N1Cc2ccccc2C1=O |
|
~%
2-(3-oxo-1H-iso... CAS#:26577-32-2 |
| Literature: Shah, Jamshed H.; Swartz, Glenn M.; Papathanassiu, Adonia E.; Treston, Anthony M.; Fogler, William E.; Madsen, John W.; Green, Shawn J. Journal of Medicinal Chemistry, 1999 , vol. 42, # 16 p. 3014 - 3017 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-phthalimidinoglutaric acid |
| 2-(1-oxo-1,3-dihydro-2h-isoindol-2-yl)pentanedioic acid |
| 2-(1-Oxoisoindolin-2-yl)-glutar-saeure |
| 2-(1-oxo-1,3-dihydro-isoindol-2-yl)-pentanedioic acid |