3-[[dimethyl(3-oxopropyl)silyl]oxy-dimethylsilyl]propanal structure
|
Common Name | 3-[[dimethyl(3-oxopropyl)silyl]oxy-dimethylsilyl]propanal | ||
|---|---|---|---|---|
| CAS Number | 26542-47-2 | Molecular Weight | 246.45100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H22O3Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-[[dimethyl(3-oxopropyl)silyl]oxy-dimethylsilyl]propanal |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H22O3Si2 |
|---|---|
| Molecular Weight | 246.45100 |
| Exact Mass | 246.11100 |
| PSA | 43.37000 |
| LogP | 2.59120 |
| InChIKey | KNFKLYVRZGILIU-UHFFFAOYSA-N |
| SMILES | C[Si](C)(CCC=O)O[Si](C)(C)CCC=O |
|
~91%
3-[[dimethyl(3-... CAS#:26542-47-2 |
| Literature: Fritz-Langhals, Elke Organic Process Research and Development, 2005 , vol. 9, # 5 p. 577 - 582 |
|
~%
3-[[dimethyl(3-... CAS#:26542-47-2 |
| Literature: Dennis,W.E.; Ryan,J.W. Journal of Organic Chemistry, 1970 , vol. 35, p. 4180 - 4183 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| Propanal,3,3'-(1,1,3,3-tetramethyl-1,3-disiloxanediyl)bis |