4-[(Dimethylamino)methyl]-9H-xanthen-9-one structure
|
Common Name | 4-[(Dimethylamino)methyl]-9H-xanthen-9-one | ||
|---|---|---|---|---|
| CAS Number | 26538-97-6 | Molecular Weight | 253.29600 | |
| Density | 1.205g/cm3 | Boiling Point | 397ºC at 760mmHg | |
| Molecular Formula | C16H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.9ºC | |
| Name | 4-[(dimethylamino)methyl]xanthen-9-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.205g/cm3 |
|---|---|
| Boiling Point | 397ºC at 760mmHg |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.29600 |
| Flash Point | 193.9ºC |
| Exact Mass | 253.11000 |
| PSA | 33.45000 |
| LogP | 3.00780 |
| Vapour Pressure | 1.64E-06mmHg at 25°C |
| Index of Refraction | 1.615 |
| InChIKey | OBVFCLYRXRAJAB-UHFFFAOYSA-N |
| SMILES | CN(C)Cc1cccc2c(=O)c3ccccc3oc12 |
| HS Code | 2932999099 |
|---|
|
~%
4-[(Dimethylami... CAS#:26538-97-6 |
| Literature: Da Re,P. et al. Chimica Therapeutica, 1970 , vol. 5, p. 119 - 120 |
|
~%
4-[(Dimethylami... CAS#:26538-97-6 |
| Literature: Da Re,P. et al. Chimica Therapeutica, 1970 , vol. 5, p. 119 - 120 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-(Dimethylamino)methylxanthen-9-one |
| 9H-Xanthen-9-one,4-[(dimethylamino)methyl] |
| Xanthen-9-one,4-(dimethylamino)methyl |