Cap-dependent endonuclease-IN-24 structure
|
Common Name | Cap-dependent endonuclease-IN-24 | ||
|---|---|---|---|---|
| CAS Number | 2649000-32-6 | Molecular Weight | 719.73 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C34H40F2N3O8PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Cap-dependent endonuclease-IN-24Cap-dependent endonuclease-IN-24 is a potent cap-dependent endonuclease (CEN) inhibitor (CN112876510A, DSC1103)[1]. |
| Name | Cap-dependent endonuclease-IN-24 |
|---|
| Description | Cap-dependent endonuclease-IN-24 is a potent cap-dependent endonuclease (CEN) inhibitor (CN112876510A, DSC1103)[1]. |
|---|---|
| Related Catalog | |
| References |
[1]. Phosphate polycyclic compound, and pharmaceutical composition and application thereof. CN112876510A. |
| Molecular Formula | C34H40F2N3O8PS |
|---|---|
| Molecular Weight | 719.73 |
| InChIKey | YSPBXSOXQGSTSP-PXJZQJOASA-N |
| SMILES | CC(C)(C)OP(=O)(OCCOc1c2n(ccc1=O)N(C1c3ccccc3SCc3c1ccc(F)c3F)C1COCCN1C2=O)OC(C)(C)C |