bis[2-[ethyl(3-methylphenyl)amino]ethyl] adipate
Modify Date: 2025-09-18 12:15:59
![bis[2-[ethyl(3-methylphenyl)amino]ethyl] adipate Structure](https://image.chemsrc.com/caspic/192/26479-97-0.png)
bis[2-[ethyl(3-methylphenyl)amino]ethyl] adipate structure
|
Common Name | bis[2-[ethyl(3-methylphenyl)amino]ethyl] adipate | ||
|---|---|---|---|---|
| CAS Number | 26479-97-0 | Molecular Weight | 468.62800 | |
| Density | 1.087g/cm3 | Boiling Point | 586.4ºC at 760mmHg | |
| Molecular Formula | C28H40N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 308.4ºC | |
| Name | bis[2-(N-ethyl-3-methylanilino)ethyl] hexanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.087g/cm3 |
|---|---|
| Boiling Point | 586.4ºC at 760mmHg |
| Molecular Formula | C28H40N2O4 |
| Molecular Weight | 468.62800 |
| Flash Point | 308.4ºC |
| Exact Mass | 468.29900 |
| PSA | 59.08000 |
| LogP | 5.30300 |
| Vapour Pressure | 9.85E-14mmHg at 25°C |
| Index of Refraction | 1.556 |
| InChIKey | GSGOXDRESSXNBM-UHFFFAOYSA-N |
| SMILES | CCN(CCOC(=O)CCCCC(=O)OCCN(CC)c1cccc(C)c1)c1cccc(C)c1 |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| Bis(2-(ethyl(3-methylphenyl)amino)ethyl) adipate |
| EINECS 247-729-2 |