cis-Parinaric Acid methyl ester structure
|
Common Name | cis-Parinaric Acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 26474-40-8 | Molecular Weight | 290.440 | |
| Density | 0.9±0.1 g/cm3 | Boiling Point | 395.1±21.0 °C at 760 mmHg | |
| Molecular Formula | C19H30O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 116.5±20.4 °C | |
| Name | cis-Parinaric Acid methyl ester |
|---|---|
| Synonym | More Synonyms |
| Density | 0.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 395.1±21.0 °C at 760 mmHg |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.440 |
| Flash Point | 116.5±20.4 °C |
| Exact Mass | 290.224579 |
| PSA | 26.30000 |
| LogP | 6.61 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.487 |
| InChIKey | JOSZZTLGHRSLOI-DFJBQONRSA-N |
| SMILES | CCC=CC=CC=CC=CCCCCCCCC(=O)OC |
| HS Code | 2916190090 |
|---|
| HS Code | 2916190090 |
|---|---|
| Summary | 2916190090 unsaturated acyclic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| 9,11,13,15-Octadecatetraenoic acid, methyl ester, (9Z,11E,13E,15Z)- |
| Methyl (9E,11E,13E,15E)-9,11,13,15-octadecatetraenoate |
| Octadeca-9c,11t,13t,15c-tetraensaeure-methylester |
| 9,11,13,15-Octadecatetraenoic acid, methyl ester, (Z,Z,E,E)- |
| 9,11,13,15-Octadecatetraenoic acid, methyl ester, (9E,11E,13E,15E)- |
| octadeca-9c,11t,13t,15c-tetraenoic acid methyl ester |
| 9,11,13,15-cis,trans,trans,cis-Octadecatetraensaeuremethylester |
| Methyl (9Z,11E,13E,15Z)-9,11,13,15-octadecatetraenoate |