Benzaldehyde,4-[bis(2-chloroethyl)amino]-2-methyl- structure
|
Common Name | Benzaldehyde,4-[bis(2-chloroethyl)amino]-2-methyl- | ||
|---|---|---|---|---|
| CAS Number | 26459-95-0 | Molecular Weight | 260.16000 | |
| Density | 1.232g/cm3 | Boiling Point | 407ºC at 760 mmHg | |
| Molecular Formula | C12H15Cl2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200ºC | |
| Name | 4-[bis(2-chloroethyl)amino]-2-methylbenzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.232g/cm3 |
|---|---|
| Boiling Point | 407ºC at 760 mmHg |
| Molecular Formula | C12H15Cl2NO |
| Molecular Weight | 260.16000 |
| Flash Point | 200ºC |
| Exact Mass | 259.05300 |
| PSA | 20.31000 |
| LogP | 3.09150 |
| Vapour Pressure | 7.78E-07mmHg at 25°C |
| Index of Refraction | 1.588 |
| InChIKey | ZQIAXDULHBLZJE-UHFFFAOYSA-N |
| SMILES | Cc1cc(N(CCCl)CCCl)ccc1C=O |
| HS Code | 2922399090 |
|---|
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-[bis-(2-chloro-ethyl)-amino]-2-methyl-benzaldehyde |
| 4-<Bis-(2-chloraethyl)amino>-o-toluylaldehyd |
| FR-0041 |
| 4-N,N-Bis(2-chloroethyl)amino-2-tolualdehyde |
| 4-<N.N-Bis-(2-chlor-aethyl)-amino>-2-methyl-benzaldehyd |
| o-Tolualdehyde,4-(bis(2-chloroethyl)amino) |
| 2-Methyl-4-<N,N-bis-(2-chlor-aethyl)-amino>-benzaldehyd |