2-ethoxy-1,1,1-trinitropropane
Modify Date: 2025-09-22 10:12:53
2-ethoxy-1,1,1-trinitropropane structure
|
Common Name | 2-ethoxy-1,1,1-trinitropropane | ||
|---|---|---|---|---|
| CAS Number | 26459-85-8 | Molecular Weight | 223.14100 | |
| Density | 1.428g/cm3 | Boiling Point | 242.4ºC at 760mmHg | |
| Molecular Formula | C5H9N3O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 96.8ºC | |
| Name | 2-ethoxy-1,1,1-trinitropropane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.428g/cm3 |
|---|---|
| Boiling Point | 242.4ºC at 760mmHg |
| Molecular Formula | C5H9N3O7 |
| Molecular Weight | 223.14100 |
| Flash Point | 96.8ºC |
| Exact Mass | 223.04400 |
| PSA | 146.69000 |
| LogP | 1.46490 |
| Vapour Pressure | 0.034mmHg at 25°C |
| Index of Refraction | 1.487 |
| InChIKey | HTKFBMXRRYDJDL-UHFFFAOYSA-N |
| SMILES | CCOC(C)C([N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-] |
| 2-ethoxy-1,1,1-trinitro-propane |
| 1,1,1-Trinitro-2-ethoxypropane |
| ethyl ether of 1,1,1-trinitro-2-propanol |
| 1-Methyl-2,2,2-trinitroethyl-ethylether |