bis(p-octyloxybenzylidene) 2-chloro-1,4-phenylenediamine
Modify Date: 2025-09-24 20:31:46
bis(p-octyloxybenzylidene) 2-chloro-1,4-phenylenediamine structure
|
Common Name | bis(p-octyloxybenzylidene) 2-chloro-1,4-phenylenediamine | ||
|---|---|---|---|---|
| CAS Number | 26456-28-0 | Molecular Weight | 575.22400 | |
| Density | 1.03g/cm3 | Boiling Point | 695.8ºC at 760 mmHg | |
| Molecular Formula | C36H47ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 374.6ºC | |
| Name | bis(p-octyloxybenzylidene) 2-chloro-1,4-phenylenediamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.03g/cm3 |
|---|---|
| Boiling Point | 695.8ºC at 760 mmHg |
| Molecular Formula | C36H47ClN2O2 |
| Molecular Weight | 575.22400 |
| Flash Point | 374.6ºC |
| Exact Mass | 574.33300 |
| PSA | 43.18000 |
| LogP | 11.31980 |
| Vapour Pressure | 2.06E-18mmHg at 25°C |
| Index of Refraction | 1.538 |
| InChIKey | MDHKESNCDKIVKS-UHFFFAOYSA-N |
| SMILES | CCCCCCCCOc1ccc(C=Nc2ccc(N=Cc3ccc(OCCCCCCCC)cc3)c(Cl)c2)cc1 |
| HS Code | 2922299090 |
|---|
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| bis-(4'-n-octyloxy benzal)-2-chloro-1,4-phenylenediamine |
| Bis-(4'-n-octyloxy-benzol)-2-chlor-1,4-phenylendiamin (BOCP) |
| 2-Chloro-N,N'-bis[[4-(octyloxy)phenyl]methylene]-1,4-benzenediamine |
| Bis-(4'-n-octyloxybenzal)-2-chloro-1,4-phenylendiamin |
| 4,4'-Bis-(4-octyloxy-benzyliden)-2-chlor-1,4-phenylendiamin |