2-[bis(3-methylbutyl)amino]acetohydrazide structure
|
Common Name | 2-[bis(3-methylbutyl)amino]acetohydrazide | ||
|---|---|---|---|---|
| CAS Number | 2644-39-5 | Molecular Weight | 229.36200 | |
| Density | 0.939g/cm3 | Boiling Point | 355.6ºC at 760 mmHg | |
| Molecular Formula | C12H27N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 168.9ºC | |
| Name | 2-[bis(3-methylbutyl)amino]acetohydrazide |
|---|---|
| Synonym | More Synonyms |
| Density | 0.939g/cm3 |
|---|---|
| Boiling Point | 355.6ºC at 760 mmHg |
| Molecular Formula | C12H27N3O |
| Molecular Weight | 229.36200 |
| Flash Point | 168.9ºC |
| Exact Mass | 229.21500 |
| PSA | 61.85000 |
| LogP | 2.91110 |
| Vapour Pressure | 3.09E-05mmHg at 25°C |
| Index of Refraction | 1.472 |
| InChIKey | DZXVCUMOIWJBLL-UHFFFAOYSA-N |
| SMILES | CC(C)CCN(CCC(C)C)CC(=O)NN |
|
~%
2-[bis(3-methyl... CAS#:2644-39-5 |
| Literature: Rips,R. et al. Journal of Medicinal Chemistry, 1965 , vol. 8, p. 529 - 531 |
|
~%
2-[bis(3-methyl... CAS#:2644-39-5 |
| Literature: Rips,R. et al. Journal of Medicinal Chemistry, 1965 , vol. 8, p. 529 - 531 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| GLYCINE,N,N-DIISOPENTYL-,HYDRAZIDE |
| N,N-Diisopentylglycinhydrazid |
| N,N-Diisopentylglycine hydrazide |
| N,N-bis-(3-methyl-butyl)-glycine hydrazide |