Daidzein 4’-β-D-Glucuronide
Modify Date: 2025-09-13 08:20:42
Daidzein 4’-β-D-Glucuronide structure
|
Common Name | Daidzein 4’-β-D-Glucuronide | ||
|---|---|---|---|---|
| CAS Number | 264236-77-3 | Molecular Weight | 430.36 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H18O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Daidzein 4’-β-D-GlucuronideDaidzein 4'-β-D-glucuronide (Compound M4) is a metabolite of Daidzein (HY-N0019)[1]. |
| Name | (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[4-(7-hydroxy-4-oxochromen-3-yl)phenoxy]oxane-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Daidzein 4'-β-D-glucuronide (Compound M4) is a metabolite of Daidzein (HY-N0019)[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C21H18O10 |
|---|---|
| Molecular Weight | 430.36 |
| Exact Mass | 430.09000 |
| PSA | 166.89000 |
| LogP | 0.43660 |
| InChIKey | ATUYSKUVHUPXBV-ZFORQUDYSA-N |
| SMILES | O=C(O)C1OC(Oc2ccc(-c3coc4cc(O)ccc4c3=O)cc2)C(O)C(O)C1O |
| 4-(7-Hydroxy-4-oxo-4H-1-benzopyran-3-yl)phenyl |A-D-Glucopyranosiduronic Acid |
| Daidzein 4'-|A-D-Glucuronide |