m-aminophenyl benzenesulphonate
Modify Date: 2025-08-26 09:09:40
m-aminophenyl benzenesulphonate structure
|
Common Name | m-aminophenyl benzenesulphonate | ||
|---|---|---|---|---|
| CAS Number | 26408-93-5 | Molecular Weight | 249.28600 | |
| Density | 1.344g/cm3 | Boiling Point | 451.3ºC at 760mmHg | |
| Molecular Formula | C12H11NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 226.7ºC | |
| Name | (3-aminophenyl) benzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.344g/cm3 |
|---|---|
| Boiling Point | 451.3ºC at 760mmHg |
| Molecular Formula | C12H11NO3S |
| Molecular Weight | 249.28600 |
| Flash Point | 226.7ºC |
| Exact Mass | 249.04600 |
| PSA | 77.77000 |
| LogP | 3.69850 |
| Vapour Pressure | 2.46E-08mmHg at 25°C |
| Index of Refraction | 1.626 |
| InChIKey | DGMUOPTYPWAHII-UHFFFAOYSA-N |
| SMILES | Nc1cccc(OS(=O)(=O)c2ccccc2)c1 |
| HS Code | 2922199090 |
|---|
|
~92%
m-aminophenyl b... CAS#:26408-93-5 |
| Literature: Tappe, Horst Synthesis, 1980 , # 7 p. 577 - 578 |
|
~0%
m-aminophenyl b... CAS#:26408-93-5
Detail
|
| Literature: Tappe, Horst Synthesis, 1980 , # 7 p. 577 - 578 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| m-Aminophenyl benzenesulphonate |
| 1-Amino-3-benzolsulfoxy-benzol |
| 3-aminophenyl phenyl sulfonate |
| 3-Aminophenyl-benzolsulfonat |
| 3-aminophenyl benzenesulfonate |
| Phenol,3-amino-,1-benzenesulfonate |
| 3-phenylsulphonyloxyaniline |
| m-aminophenyl benzenesulfonate |
| EINECS 247-677-0 |