Rezatapopt
Modify Date: 2025-08-25 12:50:32
Rezatapopt structure
|
Common Name | Rezatapopt | ||
|---|---|---|---|---|
| CAS Number | 2636846-41-6 | Molecular Weight | 545.57 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H31F4N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of RezatapoptRezatapopt is an antineoplastic agent, used to inhibit solid tumor with p53 mutation[1]. |
| Name | Rezatapopt |
|---|
| Description | Rezatapopt is an antineoplastic agent, used to inhibit solid tumor with p53 mutation[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C28H31F4N5O2 |
|---|---|
| Molecular Weight | 545.57 |
| InChIKey | NKRKBSQLUPEVCZ-JTHBVZDNSA-N |
| SMILES | CNC(=O)c1ccc(NCC#Cc2cc3c(NC4CCN(C)CC4F)cccc3n2CC(F)(F)F)c(OC)c1 |