methyl 6-(dimethylamino)-4-hydroxynaphthalene-2-carboxylate structure
|
Common Name | methyl 6-(dimethylamino)-4-hydroxynaphthalene-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 263026-75-1 | Molecular Weight | 245.27400 | |
| Density | N/A | Boiling Point | 441.9ºC at 760 mmHg | |
| Molecular Formula | C14H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 221.1ºC | |
| Name | methyl 6-(dimethylamino)-4-hydroxynaphthalene-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 441.9ºC at 760 mmHg |
|---|---|
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.27400 |
| Flash Point | 221.1ºC |
| Exact Mass | 245.10500 |
| PSA | 49.77000 |
| LogP | 2.39800 |
| Vapour Pressure | 2.02E-08mmHg at 25°C |
| Index of Refraction | 1.648 |
| InChIKey | NGYJVUQZTJCWLD-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(O)c2cc(N(C)C)ccc2c1 |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| methyl 6-dimethylamino-4-hydroxy-2-naphthoate |