2-benzofuran-1,3-dione,furan-2,5-dione,1-(2-hydroxypropoxy)propan-2-ol
Modify Date: 2024-01-16 17:16:39
2-benzofuran-1,3-dione,furan-2,5-dione,1-(2-hydroxypropoxy)propan-2-ol structure
|
Common Name | 2-benzofuran-1,3-dione,furan-2,5-dione,1-(2-hydroxypropoxy)propan-2-ol | ||
|---|---|---|---|---|
| CAS Number | 26301-25-7 | Molecular Weight | 380.34600 | |
| Density | N/A | Boiling Point | 295ºC at 760 mmHg | |
| Molecular Formula | C18H20O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 139.7ºC | |
| Name | 2-benzofuran-1,3-dione,furan-2,5-dione,1-(2-hydroxypropoxy)propan-2-ol |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 295ºC at 760 mmHg |
|---|---|
| Molecular Formula | C18H20O9 |
| Molecular Weight | 380.34600 |
| Flash Point | 139.7ºC |
| Exact Mass | 380.11100 |
| PSA | 136.43000 |
| LogP | 0.38780 |
| Vapour Pressure | 0.00157mmHg at 25°C |
| InChIKey | ZZZOJIYHKMLIFR-UHFFFAOYSA-N |
| SMILES | CC(O)COCC(C)O.O=C1C=CC(=O)O1.O=C1OC(=O)c2ccccc21 |
| 1,3-Isobenzofurandione,polymer with 2,5-furandione and 1,1'-oxybis(2-propanol) |
| Phthalic anhydride,polyester with dipropylene glycol and maleic anhydride |