mp-dLAE-PABC-MMAE
Modify Date: 2025-09-28 17:36:39
mp-dLAE-PABC-MMAE structure
|
Common Name | mp-dLAE-PABC-MMAE | ||
|---|---|---|---|---|
| CAS Number | 2625616-44-4 | Molecular Weight | 1331.59 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C68H102N10O17 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of mp-dLAE-PABC-MMAEmp-dLAE-PABC-MMAE is a drug-linker conjugate for ADC. mp-dLAE-PABC-MMAE contains a potent tubulin inhibitor Monomethyl auristatin E (HY-15162). mp-dLAE-PABC-MMAE can be used to synthesis antibody-drug conjugates (ADCs)[1]. |
| Name | mp-dLAE-PABC-MMAE |
|---|
| Description | mp-dLAE-PABC-MMAE is a drug-linker conjugate for ADC. mp-dLAE-PABC-MMAE contains a potent tubulin inhibitor Monomethyl auristatin E (HY-15162). mp-dLAE-PABC-MMAE can be used to synthesis antibody-drug conjugates (ADCs)[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C68H102N10O17 |
|---|---|
| Molecular Weight | 1331.59 |
| InChIKey | BIASWKCAJQBPJZ-GZPSSCKOSA-N |
| SMILES | CCC(C)C(C(CC(=O)N1CCCC1C(OC)C(C)C(=O)NC(C)C(O)c1ccccc1)OC)N(C)C(=O)C(NC(=O)C(C(C)C)N(C)C(=O)OCc1ccc(NC(=O)C(CCC(=O)O)NC(=O)C(C)NC(=O)C(CC(C)C)NC(=O)CCN2C(=O)C=CC2=O)cc1)C(C)C |