Naphtho[2,3-c]furan-4,9-dione, 1,3-diphenyl-
Modify Date: 2025-09-16 22:41:45
![Naphtho[2,3-c]furan-4,9-dione, 1,3-diphenyl- Structure](https://image.chemsrc.com/caspic/014/26252-50-6.png)
Naphtho[2,3-c]furan-4,9-dione, 1,3-diphenyl- structure
|
Common Name | Naphtho[2,3-c]furan-4,9-dione, 1,3-diphenyl- | ||
|---|---|---|---|---|
| CAS Number | 26252-50-6 | Molecular Weight | 350.36600 | |
| Density | 1.286g/cm3 | Boiling Point | 591.8ºC at 760 mmHg | |
| Molecular Formula | C24H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 297.5ºC | |
| Name | 1,3-diphenylbenzo[f][2]benzofuran-4,9-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.286g/cm3 |
|---|---|
| Boiling Point | 591.8ºC at 760 mmHg |
| Molecular Formula | C24H14O3 |
| Molecular Weight | 350.36600 |
| Flash Point | 297.5ºC |
| Exact Mass | 350.09400 |
| PSA | 47.28000 |
| LogP | 5.38900 |
| Vapour Pressure | 5.6E-14mmHg at 25°C |
| Index of Refraction | 1.656 |
| InChIKey | OJZPRMUUKPDVSJ-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)c2c(-c3ccccc3)oc(-c3ccccc3)c21 |
|
~%
Naphtho[2,3-c]f... CAS#:26252-50-6 |
| Literature: Nightingale; Sukornick Journal of Organic Chemistry, 1959 , vol. 24, p. 497,500 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1,3-Diphenylfuro<3,4-b>chromon |
| 4,9-Dioxo-1,3-diphenyl-4,9-dihydro-(naphtho<2,3-c>-furan) |
| diphenyl-1,3 naphto<2,3-c>furannequinone-4,9 |
| 1,3-diphenyl-naphtho[2,3-c]furan-4,9-quinone |
| 1,3-Diphenyl-naphtho[2,3-c]furan-4,9-chinon |
| 1,3-DIPHENYLNAPHTHO[2,3-C]FURAN-4,9-DIONE |
| 1,3-Diphenyl-4,9-dihydronaphtho<2,3-c>furan-4,9-dion |