2-(p-Pentoxybenzylidene)propanehydroxamic acid structure
|
Common Name | 2-(p-Pentoxybenzylidene)propanehydroxamic acid | ||
|---|---|---|---|---|
| CAS Number | 26228-15-9 | Molecular Weight | 263.33200 | |
| Density | 1.096g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C15H21NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (E)-N-hydroxy-2-methyl-3-(4-pentoxyphenyl)prop-2-enamide |
|---|
| Density | 1.096g/cm3 |
|---|---|
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.33200 |
| Exact Mass | 263.15200 |
| PSA | 62.05000 |
| LogP | 4.00460 |
| Index of Refraction | 1.554 |
| InChIKey | NYOXUFIGYAMVOL-VAWYXSNFSA-N |
| SMILES | CCCCCOc1ccc(C=C(C)C(=O)NO)cc1 |
| HS Code | 2925290090 |
|---|
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |