2-methyl-5-(trifluoromethyl)benzamide
Modify Date: 2025-08-21 19:44:16
2-methyl-5-(trifluoromethyl)benzamide structure
|
Common Name | 2-methyl-5-(trifluoromethyl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 261951-97-7 | Molecular Weight | 203.16100 | |
| Density | 1.286g/cm3 | Boiling Point | 224.6ºC at 760mmHg | |
| Molecular Formula | C9H8F3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 89.6ºC | |
| Name | 2-methyl-5-(trifluoromethyl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.286g/cm3 |
|---|---|
| Boiling Point | 224.6ºC at 760mmHg |
| Molecular Formula | C9H8F3NO |
| Molecular Weight | 203.16100 |
| Flash Point | 89.6ºC |
| Exact Mass | 203.05600 |
| PSA | 43.09000 |
| LogP | 2.81300 |
| Vapour Pressure | 0.0904mmHg at 25°C |
| Index of Refraction | 1.481 |
| InChIKey | WPKYOPRYNZOLOF-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(F)(F)F)cc1C(N)=O |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| PC0441 |
| JRD-1216 |
| 3-Carbamoyl-4-methylbenzotrifluoride |