Phenol,3-[2-(2-amino-4-phenyl-5-thiazolyl)diazenyl]- structure
|
Common Name | Phenol,3-[2-(2-amino-4-phenyl-5-thiazolyl)diazenyl]- | ||
|---|---|---|---|---|
| CAS Number | 26179-20-4 | Molecular Weight | 296.34700 | |
| Density | 1.4g/cm3 | Boiling Point | 465ºC at 760mmHg | |
| Molecular Formula | C15H12N4OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235ºC | |
| Name | 3-[(2E)-2-(2-imino-4-phenyl-1,3-thiazol-5-ylidene)hydrazinyl]phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4g/cm3 |
|---|---|
| Boiling Point | 465ºC at 760mmHg |
| Molecular Formula | C15H12N4OS |
| Molecular Weight | 296.34700 |
| Flash Point | 235ºC |
| Exact Mass | 296.07300 |
| PSA | 112.10000 |
| LogP | 5.09450 |
| Vapour Pressure | 2.86E-09mmHg at 25°C |
| Index of Refraction | 1.723 |
| InChIKey | TUHJNDBTSGUEIP-UHFFFAOYSA-N |
| SMILES | Nc1nc(-c2ccccc2)c(N=Nc2cccc(O)c2)s1 |
|
~%
Phenol,3-[2-(2-... CAS#:26179-20-4 |
| Literature: Garg; Sharma Journal of pharmaceutical sciences, 1970 , vol. 59, # 3 p. 348 - 353 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-(2-amino-4-phenyl-thiazol-5-ylazo)-phenol |