Thiourea,N-phenyl-N'-[4-phenyl-5-(2-phenyldiazenyl)-2-thiazolyl]- structure
|
Common Name | Thiourea,N-phenyl-N'-[4-phenyl-5-(2-phenyldiazenyl)-2-thiazolyl]- | ||
|---|---|---|---|---|
| CAS Number | 26164-73-8 | Molecular Weight | 415.53400 | |
| Density | 1.3g/cm3 | Boiling Point | 567.1ºC at 760mmHg | |
| Molecular Formula | C22H17N5S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 296.8ºC | |
| Name | (3E)-1-phenyl-3-[(5E)-4-phenyl-5-(phenylhydrazinylidene)-1,3-thiazol-2-ylidene]thiourea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 567.1ºC at 760mmHg |
| Molecular Formula | C22H17N5S2 |
| Molecular Weight | 415.53400 |
| Flash Point | 296.8ºC |
| Exact Mass | 415.09300 |
| PSA | 122.00000 |
| LogP | 7.18040 |
| Vapour Pressure | 7.05E-13mmHg at 25°C |
| Index of Refraction | 1.705 |
| InChIKey | OBWUJDJNCSAJII-UHFFFAOYSA-N |
| SMILES | S=C(Nc1ccccc1)Nc1nc(-c2ccccc2)c(N=Nc2ccccc2)s1 |
|
~%
Thiourea,N-phen... CAS#:26164-73-8 |
| Literature: Garg; Sharma Journal of pharmaceutical sciences, 1970 , vol. 59, # 3 p. 348 - 353 |
|
~%
Thiourea,N-phen... CAS#:26164-73-8 |
| Literature: Garg; Sharma Journal of pharmaceutical sciences, 1970 , vol. 59, # 3 p. 348 - 353 |
|
~%
Thiourea,N-phen... CAS#:26164-73-8 |
| Literature: Garg; Sharma Journal of pharmaceutical sciences, 1970 , vol. 59, # 3 p. 348 - 353 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1-phenyl-3-(4-phenyl-5-phenylazo-thiazol-2-yl)-thiourea |