9H-Pyrido(2,3-b)indol-2-ol structure
|
Common Name | 9H-Pyrido(2,3-b)indol-2-ol | ||
|---|---|---|---|---|
| CAS Number | 26148-60-7 | Molecular Weight | 184.19400 | |
| Density | 1.369g/cm3 | Boiling Point | 507ºC at 760 mmHg | |
| Molecular Formula | C11H8N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 260.4ºC | |
| Name | 1,9-dihydropyrido[2,3-b]indol-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.369g/cm3 |
|---|---|
| Boiling Point | 507ºC at 760 mmHg |
| Molecular Formula | C11H8N2O |
| Molecular Weight | 184.19400 |
| Flash Point | 260.4ºC |
| Exact Mass | 184.06400 |
| PSA | 48.91000 |
| LogP | 2.42170 |
| Vapour Pressure | 2.11E-10mmHg at 25°C |
| Index of Refraction | 1.731 |
| InChIKey | YRSHFGZLQABDFW-UHFFFAOYSA-N |
| SMILES | O=c1ccc2c([nH]1)[nH]c1ccccc12 |
| HS Code | 2933990090 |
|---|
|
~0%
9H-Pyrido(2,3-b... CAS#:26148-60-7 |
| Literature: Jarman, M.; Leung, C-S.; Manson, D. Synthesis, 1984 , # 12 p. 1061 - 1062 |
|
~%
9H-Pyrido(2,3-b... CAS#:26148-60-7 |
| Literature: Jarman, M.; Leung, C-S.; Manson, D. Synthesis, 1984 , # 12 p. 1061 - 1062 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2H-Pyrido[2,3-b]indol-2-one,1,9-dihydro |
| 1,9-dihydro-pyrido[2,3-b]indol-2-one |
| 2-Hydroxy-a-carboline |
| 9H-Pyrido[2,3-b]indol-2-ol(8CI) |
| 2-Hydroxy-9H-pyrido<2,3-b>indole |
| 9H-Pyrido(2,3-b)indol-2-ol |