n-(2-tetrahydrofuranmethyl)phthalimide
Modify Date: 2025-09-11 16:36:00
n-(2-tetrahydrofuranmethyl)phthalimide structure
|
Common Name | n-(2-tetrahydrofuranmethyl)phthalimide | ||
|---|---|---|---|---|
| CAS Number | 26116-10-9 | Molecular Weight | 231.24700 | |
| Density | 1.314g/cm3 | Boiling Point | 370.2ºC at 760 mmHg | |
| Molecular Formula | C13H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177.7ºC | |
| Name | n-(2-tetrahydrofuranmethyl)phthalimide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.314g/cm3 |
|---|---|
| Boiling Point | 370.2ºC at 760 mmHg |
| Molecular Formula | C13H13NO3 |
| Molecular Weight | 231.24700 |
| Flash Point | 177.7ºC |
| Exact Mass | 231.09000 |
| PSA | 46.61000 |
| LogP | 1.39950 |
| Vapour Pressure | 1.13E-05mmHg at 25°C |
| Index of Refraction | 1.602 |
| InChIKey | ZNBXDWLLIYOFNP-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)N1CC1CCCO1 |
| HS Code | 2934999090 |
|---|
|
~98%
n-(2-tetrahydro... CAS#:26116-10-9 |
| Literature: Kawakami, Hiroshi; Ebata, Takashi; Matsushita, Hajime Agricultural and Biological Chemistry, 1991 , vol. 55, # 6 p. 1687 - 1688 |
|
~%
n-(2-tetrahydro... CAS#:26116-10-9 |
| Literature: Spillmann; Hoffmann Helvetica Chimica Acta, 1954 , vol. 37, p. 1699,1701, 1704 |
CAS#:5451-09-2
CAS#:92632-81-0| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-tetrahydrofurfurylphthalimide |