Potassium 4-(methoxycarbonyl)phenolate structure
|
Common Name | Potassium 4-(methoxycarbonyl)phenolate | ||
|---|---|---|---|---|
| CAS Number | 26112-07-2 | Molecular Weight | 190.23800 | |
| Density | N/A | Boiling Point | 265.5ºC at 760mmHg | |
| Molecular Formula | C8H7KO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 116.4ºC | |
| Name | Potassium 4-(methoxycarbonyl)phenolate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 265.5ºC at 760mmHg |
|---|---|
| Molecular Formula | C8H7KO3 |
| Molecular Weight | 190.23800 |
| Flash Point | 116.4ºC |
| Exact Mass | 190.00300 |
| PSA | 49.36000 |
| LogP | 1.61700 |
| Vapour Pressure | 0.00555mmHg at 25°C |
| InChIKey | MOCBTMXJPWSHOD-UHFFFAOYSA-M |
| SMILES | COC(=O)c1ccc([O-])cc1.[K+] |
| HS Code | 2918290000 |
|---|
|
~%
Potassium 4-(me... CAS#:26112-07-2 |
| Literature: Bayer Aktiengesellschaft Patent: US4276431 A1, 1981 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
| potassium salt of methyl 4-hydroxybenzoate |
| Potassium methacrylate |
| potassium 2-methyl-2-propenoate |
| potassium 2-methylprop-2-enoate |
| potassium salt of methacrylic acid |
| potassium methylparaben |
| Potasium methacrylate |
| 2-methyl-acrylic acid potassium |
| Kaliummethacrylat |
| potassium methacrylic acid |
| potassium methyl 4-oxidobenzoate |