2,3'5,6'-Tetrahydro(2.2)paracyclophane structure
|
Common Name | 2,3'5,6'-Tetrahydro(2.2)paracyclophane | ||
|---|---|---|---|---|
| CAS Number | 26050-79-3 | Molecular Weight | 212.33000 | |
| Density | 1.01g/cm3 | Boiling Point | 382.3ºC at 760mmHg | |
| Molecular Formula | C16H20 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 159.7ºC | |
| Name | 2,3'5,6'-Tetrahydro(2.2)paracyclophane |
|---|
| Density | 1.01g/cm3 |
|---|---|
| Boiling Point | 382.3ºC at 760mmHg |
| Molecular Formula | C16H20 |
| Molecular Weight | 212.33000 |
| Flash Point | 159.7ºC |
| Exact Mass | 212.15700 |
| LogP | 4.85360 |
| Vapour Pressure | 1.05E-05mmHg at 25°C |
| Index of Refraction | 1.572 |
| InChIKey | SOYXMIFOQRQXKU-UHFFFAOYSA-N |
| SMILES | C1=C2CC=C(C1)CCC1=CCC(=CC1)CC2 |
|
~%
2,3'5,6'-Tetrah... CAS#:26050-79-3 |
| Literature: O'Connor,J.G.; Keehn,P.M. Journal of the American Chemical Society, 1976 , vol. 98, p. 8446 - 8450 |