3-phenyl-4-propan-2-yl-1H-1,2,4-triazole-5-thione
Modify Date: 2025-09-18 07:51:25
3-phenyl-4-propan-2-yl-1H-1,2,4-triazole-5-thione structure
|
Common Name | 3-phenyl-4-propan-2-yl-1H-1,2,4-triazole-5-thione | ||
|---|---|---|---|---|
| CAS Number | 26029-09-4 | Molecular Weight | 219.30600 | |
| Density | 1.21g/cm3 | Boiling Point | 377.7ºC at 760 mmHg | |
| Molecular Formula | C11H13N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.2ºC | |
| Name | 3-phenyl-4-propan-2-yl-1H-1,2,4-triazole-5-thione |
|---|
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 377.7ºC at 760 mmHg |
| Molecular Formula | C11H13N3S |
| Molecular Weight | 219.30600 |
| Flash Point | 182.2ºC |
| Exact Mass | 219.08300 |
| PSA | 69.51000 |
| LogP | 2.81470 |
| Vapour Pressure | 6.61E-06mmHg at 25°C |
| Index of Refraction | 1.644 |
| InChIKey | GYEMVRVUKFGVOL-UHFFFAOYSA-N |
| SMILES | CC(C)n1c(-c2ccccc2)n[nH]c1=S |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |