ethyl 2-cyano-3-(3,4,5-trimethoxyphenyl)prop-2-enoate structure
|
Common Name | ethyl 2-cyano-3-(3,4,5-trimethoxyphenyl)prop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 2601-03-8 | Molecular Weight | 291.29900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H17NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 2-cyano-3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H17NO5 |
|---|---|
| Molecular Weight | 291.29900 |
| Exact Mass | 291.11100 |
| PSA | 77.78000 |
| LogP | 2.18248 |
| InChIKey | NENLHUFWWOXTFW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C#N)=Cc1cc(OC)c(OC)c(OC)c1 |
|
~99%
ethyl 2-cyano-3... CAS#:2601-03-8 |
| Literature: Ilangovan; Muralidharan; Maruthamuthu Journal of the Korean Chemical Society, 2011 , vol. 55, # 6 p. 1000 - 1006 |
|
~68%
ethyl 2-cyano-3... CAS#:2601-03-8 |
| Literature: Sidhu, Anjali; Rai, Mangat Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2008 , vol. 47, # 5 p. 778 - 780 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-cyano-3-(3,4,5-trimethoxyphenyl)acrylic acid ethyl ester |
| 2-Propenoic acid,2-cyano-3-(3,4,5-trimethoxyphenyl)-,ethyl ester |
| ethyl 2-cyano-3-(3,4,5-trimethoxyphenyl)acrylate |