Urea, N-(3,5-bis(trifluoromethyl)phenyl)-N'-(4-bromo-2-(1H-tetrazol-5-yl)phenyl)
Modify Date: 2025-10-23 12:37:30
Urea, N-(3,5-bis(trifluoromethyl)phenyl)-N'-(4-bromo-2-(1H-tetrazol-5-yl)phenyl) structure
|
Common Name | Urea, N-(3,5-bis(trifluoromethyl)phenyl)-N'-(4-bromo-2-(1H-tetrazol-5-yl)phenyl) | ||
|---|---|---|---|---|
| CAS Number | 2597341-93-8 | Molecular Weight | 495.18 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H9BrF6N6O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Urea, N-(3,5-bis(trifluoromethyl)phenyl)-N'-(4-bromo-2-(1H-tetrazol-5-yl)phenyl) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H9BrF6N6O |
|---|---|
| Molecular Weight | 495.18 |
| InChIKey | OQRAKHDEGGGWQO-UHFFFAOYSA-N |
| SMILES | O=C(Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)Nc1cc(Br)ccc1-c1nn[nH]n1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Urea, N-(3,5-bis(trifluoromethyl)phenyl)-N'-(4-bromo-2-(1H-tetrazol-5-yl)phenyl)? |
| A: The English name of Urea, N-(3,5-bis(trifluoromethyl)phenyl)-N'-(4-bromo-2-(1H-tetrazol-5-yl)phenyl) is Urea, N-(3,5-bis(trifluoromethyl)phenyl)-N'-(4-bromo-2-(1H-tetrazol-5-yl)phenyl). |
| Q: What is the Chinese name of 2597341-93-8? |
| A: Chinese name of 2597341-93-8 is 2597341-93-8. |
| Q: What is the CAS number of Urea, N-(3,5-bis(trifluoromethyl)phenyl)-N'-(4-bromo-2-(1H-tetrazol-5-yl)phenyl)? |
| A: CAS number of Urea, N-(3,5-bis(trifluoromethyl)phenyl)-N'-(4-bromo-2-(1H-tetrazol-5-yl)phenyl) is 2597341-93-8. |
| Q: What is the molecular formula of Urea, N-(3,5-bis(trifluoromethyl)phenyl)-N'-(4-bromo-2-(1H-tetrazol-5-yl)phenyl)? |
| A: Molecular formula of Urea, N-(3,5-bis(trifluoromethyl)phenyl)-N'-(4-bromo-2-(1H-tetrazol-5-yl)phenyl) is C16H9BrF6N6O. |
| Q: What is the InChIKey of Urea, N-(3,5-bis(trifluoromethyl)phenyl)-N'-(4-bromo-2-(1H-tetrazol-5-yl)phenyl)? |
| A: InChIKey of Urea, N-(3,5-bis(trifluoromethyl)phenyl)-N'-(4-bromo-2-(1H-tetrazol-5-yl)phenyl) is OQRAKHDEGGGWQO-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of Urea, N-(3,5-bis(trifluoromethyl)phenyl)-N'-(4-bromo-2-(1H-tetrazol-5-yl)phenyl)? |
| A: SMILES notation of Urea, N-(3,5-bis(trifluoromethyl)phenyl)-N'-(4-bromo-2-(1H-tetrazol-5-yl)phenyl) is O=C(Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)Nc1cc(Br)ccc1-c1nn[nH]n1. |
| Q: What is the molecular weight of Urea, N-(3,5-bis(trifluoromethyl)phenyl)-N'-(4-bromo-2-(1H-tetrazol-5-yl)phenyl)? |
| A: Molecular weight of Urea, N-(3,5-bis(trifluoromethyl)phenyl)-N'-(4-bromo-2-(1H-tetrazol-5-yl)phenyl) is 495.18. |