N,N,N',N'-tetramethyl-3-naphthalen-1-ylpentane-1,5-diamine
Modify Date: 2025-08-25 11:01:51
N,N,N',N'-tetramethyl-3-naphthalen-1-ylpentane-1,5-diamine structure
|
Common Name | N,N,N',N'-tetramethyl-3-naphthalen-1-ylpentane-1,5-diamine | ||
|---|---|---|---|---|
| CAS Number | 25913-52-4 | Molecular Weight | 284.43900 | |
| Density | 0.99g/cm3 | Boiling Point | 400ºC at 760 mmHg | |
| Molecular Formula | C19H28N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 176.9ºC | |
| Name | N,N,N',N'-tetramethyl-3-naphthalen-1-ylpentane-1,5-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 0.99g/cm3 |
|---|---|
| Boiling Point | 400ºC at 760 mmHg |
| Molecular Formula | C19H28N2 |
| Molecular Weight | 284.43900 |
| Flash Point | 176.9ºC |
| Exact Mass | 284.22500 |
| PSA | 6.48000 |
| LogP | 3.82680 |
| Vapour Pressure | 1.31E-06mmHg at 25°C |
| Index of Refraction | 1.564 |
| InChIKey | IODXMEHZXKPAJF-UHFFFAOYSA-N |
| SMILES | CN(C)CCC(CCN(C)C)c1cccc2ccccc12 |
|
~%
N,N,N',N'-tetra... CAS#:25913-52-4 |
| Literature: Casadio,S. et al. Journal of Medicinal Chemistry, 1970 , vol. 13, p. 418 - 421 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3-(1-Naphthyl)-N,N,N',N',-tetramethyl-1,5-pentamethylenediamine |
| 1,5-Pentamethylenediamine,3-(1-naphthyl)-N,N,N',N'-tetramethyl |