2,3-diethyl-5,6-dimethylcyclohexa-2,5-diene-1,4-dione
Modify Date: 2025-08-30 19:43:43
2,3-diethyl-5,6-dimethylcyclohexa-2,5-diene-1,4-dione structure
|
Common Name | 2,3-diethyl-5,6-dimethylcyclohexa-2,5-diene-1,4-dione | ||
|---|---|---|---|---|
| CAS Number | 25893-85-0 | Molecular Weight | 192.25400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,3-diethyl-5,6-dimethylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H16O2 |
|---|---|
| Molecular Weight | 192.25400 |
| Exact Mass | 192.11500 |
| PSA | 34.14000 |
| LogP | 2.59120 |
| InChIKey | BPNCBCPAZYLGFJ-UHFFFAOYSA-N |
| SMILES | CCC1=C(CC)C(=O)C(C)=C(C)C1=O |
|
~78%
2,3-diethyl-5,6... CAS#:25893-85-0 |
| Literature: Liebeskind, Lanny S.; Leeds, James P.; Baysdon, Sherrol L.; Iyer, Suresh Journal of the American Chemical Society, 1984 , vol. 106, # 21 p. 6451 - 6453 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,3-diethyl-5,6-dimethylbenzoquinone |
| 2,3-dimethyl-5,6-diethyl-1,4-benzoquinone |
| 2,3-diethyl-5,6-dimethylbenzo-1,4-quinone |
| 2,3-diethyl-5,6-dimethyl-1,4-benzoquinone |
| 2,5-Cyclohexadiene-1,4-dione,2,3-diethyl-5,6-dimethyl |