Fmoc-Val-Phe-Boc
Fmoc-Val-Phe-Boc structure
|
Common Name | Fmoc-Val-Phe-Boc | ||
|---|---|---|---|---|
| CAS Number | 258879-48-0 | Molecular Weight | 542.67 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C33H38N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Fmoc-Val-Phe-BocFmoc-Val-Phe-Boc is a PROTAC linker and a maleimide-GGFG peptide linker. Fmoc-Val-Phe-Boc can be used in the synthesis of the Deruxtecan[1]. |
| Name | Fmoc-Val-Phe-Boc |
|---|
| Description | Fmoc-Val-Phe-Boc is a PROTAC linker and a maleimide-GGFG peptide linker. Fmoc-Val-Phe-Boc can be used in the synthesis of the Deruxtecan[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C33H38N2O5 |
|---|---|
| Molecular Weight | 542.67 |
| InChIKey | FMJAKMNXNWXJQP-VMPREFPWSA-N |
| SMILES | CC(C)C(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)NC(Cc1ccccc1)C(=O)OC(C)(C)C |