3-Acetyl-4-chlorobenzoic acid
Modify Date: 2026-07-16 05:58:12
3-Acetyl-4-chlorobenzoic acid structure
|
Common Name | 3-Acetyl-4-chlorobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 258273-35-7 | Molecular Weight | 198.60 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H7ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-Acetyl-4-chlorobenzoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H7ClO3 |
|---|---|
| Molecular Weight | 198.60 |
| InChIKey | YJGNQDVOOATFIT-UHFFFAOYSA-N |
| SMILES | CC(=O)c1cc(C(=O)O)ccc1Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 3-Acetyl-4-chlorobenzoic acid? |
| A: InChIKey of 3-Acetyl-4-chlorobenzoic acid is YJGNQDVOOATFIT-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 3-Acetyl-4-chlorobenzoic acid? |
| A: Molecular formula of 3-Acetyl-4-chlorobenzoic acid is C9H7ClO3. |
| Q: What is the molecular weight of 3-Acetyl-4-chlorobenzoic acid? |
| A: Molecular weight of 3-Acetyl-4-chlorobenzoic acid is 198.60. |
| Q: What is the CAS number of 3-Acetyl-4-chlorobenzoic acid? |
| A: CAS number of 3-Acetyl-4-chlorobenzoic acid is 258273-35-7. |
| Q: What is the Chinese name of 258273-35-7? |
| A: Chinese name of 258273-35-7 is 258273-35-7. |
| Q: What is the SMILES notation of 3-Acetyl-4-chlorobenzoic acid? |
| A: SMILES notation of 3-Acetyl-4-chlorobenzoic acid is CC(=O)c1cc(C(=O)O)ccc1Cl. |
| Q: What is the English name of 3-Acetyl-4-chlorobenzoic acid? |
| A: The English name of 3-Acetyl-4-chlorobenzoic acid is 3-Acetyl-4-chlorobenzoic acid. |