2,2-bis[[(1-oxoheptyl)oxy]methyl]propane-1,3-diyl bisheptanoate structure
|
Common Name | 2,2-bis[[(1-oxoheptyl)oxy]methyl]propane-1,3-diyl bisheptanoate | ||
|---|---|---|---|---|
| CAS Number | 25811-35-2 | Molecular Weight | 584.82500 | |
| Density | 0.995g/cm3 | Boiling Point | 618ºC at 760mmHg | |
| Molecular Formula | C33H60O8 | Melting Point | -1.5--0.5ºC | |
| MSDS | N/A | Flash Point | 249.7ºC | |
| Name | [3-heptanoyloxy-2,2-bis(heptanoyloxymethyl)propyl] heptanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.995g/cm3 |
|---|---|
| Boiling Point | 618ºC at 760mmHg |
| Melting Point | -1.5--0.5ºC |
| Molecular Formula | C33H60O8 |
| Molecular Weight | 584.82500 |
| Flash Point | 249.7ºC |
| Exact Mass | 584.42900 |
| PSA | 105.20000 |
| LogP | 8.02720 |
| Vapour Pressure | 3.35E-15mmHg at 25°C |
| Index of Refraction | 1.463 |
| InChIKey | NCGQPNAQUYGWMI-UHFFFAOYSA-N |
| SMILES | CCCCCCC(=O)OCC(COC(=O)CCCCCC)(COC(=O)CCCCCC)COC(=O)CCCCCC |
| HS Code | 2915900090 |
|---|
|
~91%
2,2-bis[[(1-oxo... CAS#:25811-35-2 |
| Literature: Zhang, Fengxiu; Zhang, Guangxian Green Chemistry, 2011 , vol. 13, # 1 p. 178 - 184 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| 2,2-Bis(((1-oxoheptyl)oxy)methyl)propane-1,3-diyl bisheptanoate |
| Pentaerythritol tetra-n-heptanoate |
| Pentaerythritol tetraheptanoate |
| Heptansaeure-pentaerythritolester |
| 3-(heptanoyloxy)-2,2-bis[(heptanoyloxy)methyl]propyl heptanoate |
| Tetra-O-heptanoyl-pentaerythrit |
| EINECS 247-279-7 |
| Pentaerythrit-tetraheptanoat |
| tetra-O-heptanoyl-pentaerythritol |