rac-tert-butyl (1R,5R)-5-methyl-3-azabicyclo[3.1.0]hexane-1-carboxylate
Modify Date: 2025-08-27 18:49:47
![rac-tert-butyl (1R,5R)-5-methyl-3-azabicyclo[3.1.0]hexane-1-carboxylate Structure](https://www.chemsrc.com/extcaspic/122/2580098-49-1.png)
rac-tert-butyl (1R,5R)-5-methyl-3-azabicyclo[3.1.0]hexane-1-carboxylate structure
|
Common Name | rac-tert-butyl (1R,5R)-5-methyl-3-azabicyclo[3.1.0]hexane-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 2580098-49-1 | Molecular Weight | 197.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | rac-tert-butyl (1R,5R)-5-methyl-3-azabicyclo[3.1.0]hexane-1-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H19NO2 |
|---|---|
| Molecular Weight | 197.27 |
| InChIKey | RKWVDPXCLIXQSI-WDEREUQCSA-N |
| SMILES | CC(C)(C)OC(=O)C12CNCC1(C)C2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2580098-49-1? |
| A: Chinese name of 2580098-49-1 is 2580098-49-1. |
| Q: What is the InChIKey of rac-tert-butyl (1R,5R)-5-methyl-3-azabicyclo[3.1.0]hexane-1-carboxylate? |
| A: InChIKey of rac-tert-butyl (1R,5R)-5-methyl-3-azabicyclo[3.1.0]hexane-1-carboxylate is RKWVDPXCLIXQSI-WDEREUQCSA-N. |
| Q: What is the English name of rac-tert-butyl (1R,5R)-5-methyl-3-azabicyclo[3.1.0]hexane-1-carboxylate? |
| A: The English name of rac-tert-butyl (1R,5R)-5-methyl-3-azabicyclo[3.1.0]hexane-1-carboxylate is rac-tert-butyl (1R,5R)-5-methyl-3-azabicyclo[3.1.0]hexane-1-carboxylate. |
| Q: What is the molecular formula of rac-tert-butyl (1R,5R)-5-methyl-3-azabicyclo[3.1.0]hexane-1-carboxylate? |
| A: Molecular formula of rac-tert-butyl (1R,5R)-5-methyl-3-azabicyclo[3.1.0]hexane-1-carboxylate is C11H19NO2. |
| Q: What is the molecular weight of rac-tert-butyl (1R,5R)-5-methyl-3-azabicyclo[3.1.0]hexane-1-carboxylate? |
| A: Molecular weight of rac-tert-butyl (1R,5R)-5-methyl-3-azabicyclo[3.1.0]hexane-1-carboxylate is 197.27. |
| Q: What is the SMILES notation of rac-tert-butyl (1R,5R)-5-methyl-3-azabicyclo[3.1.0]hexane-1-carboxylate? |
| A: SMILES notation of rac-tert-butyl (1R,5R)-5-methyl-3-azabicyclo[3.1.0]hexane-1-carboxylate is CC(C)(C)OC(=O)C12CNCC1(C)C2. |
| Q: What is the CAS number of rac-tert-butyl (1R,5R)-5-methyl-3-azabicyclo[3.1.0]hexane-1-carboxylate? |
| A: CAS number of rac-tert-butyl (1R,5R)-5-methyl-3-azabicyclo[3.1.0]hexane-1-carboxylate is 2580098-49-1. |