TERT-BUTYL (3-HYDROXY-3-PHENYLPROPYL)CARBAMATE structure
|
Common Name | TERT-BUTYL (3-HYDROXY-3-PHENYLPROPYL)CARBAMATE | ||
|---|---|---|---|---|
| CAS Number | 257892-43-6 | Molecular Weight | 251.32100 | |
| Density | 1.084g/cm3 | Boiling Point | 404.626ºC at 760 mmHg | |
| Molecular Formula | C14H21NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.511ºC | |
| Name | tert-butyl N-(3-hydroxy-3-phenylpropyl)carbamate |
|---|
| Density | 1.084g/cm3 |
|---|---|
| Boiling Point | 404.626ºC at 760 mmHg |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.32100 |
| Flash Point | 198.511ºC |
| Exact Mass | 251.15200 |
| PSA | 62.05000 |
| LogP | 2.83920 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.52 |
| InChIKey | UHMCJSCAZCSSEM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCC(O)c1ccccc1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2924299090 |
|
~70%
TERT-BUTYL (3-H... CAS#:257892-43-6 |
| Literature: WO2006/113837 A2, ; Page/Page column 122 ; WO 2006/113837 A2 |
|
~99%
TERT-BUTYL (3-H... CAS#:257892-43-6 |
| Literature: Advanced Synthesis and Catalysis, , vol. 346, # 2-3 p. 185 - 189 |
|
~48%
TERT-BUTYL (3-H... CAS#:257892-43-6 |
| Literature: US2003/158185 A1, ; |
|
~%
TERT-BUTYL (3-H... CAS#:257892-43-6 |
| Literature: US2012/184508 A1, ; US 20120184508 A1 US2012/184542 A1, ; US 20120184542 A1 US2012/184548 A1, ; US 20120184548 A1 US2012/184562 A1, ; US 20120184562 A1 US2012/238564 A1, ; US 20120238564 A1 |
|
~%
TERT-BUTYL (3-H... CAS#:257892-43-6 |
| Literature: Advanced Synthesis and Catalysis, , vol. 346, # 2-3 p. 185 - 189 |
|
~63%
TERT-BUTYL (3-H... CAS#:257892-43-6 |
| Literature: US2012/184548 A1, ; Page/Page column 12; 13 ; US 20120184548 A1 |
| Precursor 6 | |
|---|---|
| DownStream 3 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |