3,6,8-trichloro-1H-quinolin-4-one structure
|
Common Name | 3,6,8-trichloro-1H-quinolin-4-one | ||
|---|---|---|---|---|
| CAS Number | 25771-92-0 | Molecular Weight | 248.49300 | |
| Density | 1.645g/cm3 | Boiling Point | 370.273ºC at 760 mmHg | |
| Molecular Formula | C9H4Cl3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177.735ºC | |
| Name | 3,6,8-trichloro-1H-quinolin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.645g/cm3 |
|---|---|
| Boiling Point | 370.273ºC at 760 mmHg |
| Molecular Formula | C9H4Cl3NO |
| Molecular Weight | 248.49300 |
| Flash Point | 177.735ºC |
| Exact Mass | 246.93600 |
| PSA | 33.12000 |
| LogP | 3.90060 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.706 |
| InChIKey | CWRSVQKGDURCGF-UHFFFAOYSA-N |
| SMILES | O=c1c(Cl)c[nH]c2c(Cl)cc(Cl)cc12 |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3,6,8-TRICHLOROQUINOLIN-4-OL |
| 3,6,8-Trichloro-4-hydroxyquinoline |
| 3,6,8-Trichlor-4-hydroxychinolin |