ethyl prop-2-enoate, prop-2-enenitrile, styrene structure
|
Common Name | ethyl prop-2-enoate, prop-2-enenitrile, styrene | ||
|---|---|---|---|---|
| CAS Number | 25749-60-4 | Molecular Weight | 257.32800 | |
| Density | N/A | Boiling Point | 145.2ºC at 760mmHg | |
| Molecular Formula | C16H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 31.1ºC | |
| Name | ethyl prop-2-enoate,prop-2-enenitrile,styrene |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 145.2ºC at 760mmHg |
|---|---|
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.32800 |
| Flash Point | 31.1ºC |
| Exact Mass | 257.14200 |
| PSA | 50.09000 |
| LogP | 3.76108 |
| InChIKey | CTYOELISUWITTG-UHFFFAOYSA-N |
| SMILES | C=CC#N.C=CC(=O)OCC.C=Cc1ccccc1 |
| 2-Propenoic acid,ethyl ester,polymer with ethenylbenzene and 2-propenenitrile |