Antibacterial agent 157 structure
|
Common Name | Antibacterial agent 157 | ||
|---|---|---|---|---|
| CAS Number | 2573134-85-5 | Molecular Weight | 567.37 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H23BrF4N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Antibacterial agent 157Antibacterial agent 157 (compound B12) is a fungicidal agent. Antibacterial agent 157 can influence the protein synthesis of Botrytis cinerea. Antibacterial agent 157 can be used for gray mold resistance control research[1]. |
| Name | Antibacterial agent 157 |
|---|
| Description | Antibacterial agent 157 (compound B12) is a fungicidal agent. Antibacterial agent 157 can influence the protein synthesis of Botrytis cinerea. Antibacterial agent 157 can be used for gray mold resistance control research[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C26H23BrF4N2O3 |
|---|---|
| Molecular Weight | 567.37 |
| InChIKey | RQWPIBRBEJNVRN-UHFFFAOYSA-N |
| SMILES | Cc1c(C(=O)Nc2c(Br)cc(F)cc2C(=O)NC(C)(C)C)cccc1-c1ccc(OC(F)(F)F)cc1 |